C24H14F5NOS — CID 155260835
[4-[2-[3-ethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate (PubChem CID 155260835) has the molecular formula C24H14F5NOS and a molecular weight of 459.44 g/mol. Its IUPAC name is [4-[2-[3-ethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate.
| Compound Name | [4-[2-[3-ethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 155260835 |
| Molecular Formula | C24H14F5NOS |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | [4-[2-[3-ethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate |
| SMILES | CCc1cc(C#Cc2cc(F)c(SC#N)c(F)c2)ccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H14F5NOS/c1-2-17-11-15(3-4-16-12-21(25)23(32-14-30)22(26)13-16)5-10-20(17)18-6-8-19(9-7-18)31-24(27,28)29/h5-13H,2H2,1H3 |
| InChIKey | HEUXQAGVSQZKJW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|