C18H15F2NS — CID 145192915
[2,6-difluoro-4-[2-(4-methylphenyl)ethynyl]phenyl] thiocyanate;ethane (PubChem CID 145192915) has the molecular formula C18H15F2NS and a molecular weight of 315.39 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-(4-methylphenyl)ethynyl]phenyl] thiocyanate;ethane.
| Compound Name | [2,6-difluoro-4-[2-(4-methylphenyl)ethynyl]phenyl] thiocyanate;ethane |
|---|---|
| PubChem CID | 145192915 |
| Molecular Formula | C18H15F2NS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [2,6-difluoro-4-[2-(4-methylphenyl)ethynyl]phenyl] thiocyanate;ethane |
| SMILES | CC.Cc1ccc(C#Cc2cc(F)c(SC#N)c(F)c2)cc1 |
| InChI | InChI=1S/C16H9F2NS.C2H6/c1-11-2-4-12(5-3-11)6-7-13-8-14(17)16(20-10-19)15(18)9-13;1-2/h2-5,8-9H,1H3;1-2H3 |
| InChIKey | PQSUCBIOBUOLNR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|