C22H19F2NS — CID 146262167
[2,6-difluoro-4-[2-[4-(4-methylcyclohexyl)phenyl]ethynyl]phenyl] thiocyanate (PubChem CID 146262167) has the molecular formula C22H19F2NS and a molecular weight of 367.46 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-[4-(4-methylcyclohexyl)phenyl]ethynyl]phenyl] thiocyanate.
| Compound Name | [2,6-difluoro-4-[2-[4-(4-methylcyclohexyl)phenyl]ethynyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 146262167 |
| Molecular Formula | C22H19F2NS |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2,6-difluoro-4-[2-[4-(4-methylcyclohexyl)phenyl]ethynyl]phenyl] thiocyanate |
| SMILES | CC1CCC(c2ccc(C#Cc3cc(F)c(SC#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H19F2NS/c1-15-2-8-18(9-3-15)19-10-6-16(7-11-19)4-5-17-12-20(23)22(26-14-25)21(24)13-17/h6-7,10-13,15,18H,2-3,8-9H2,1H3 |
| InChIKey | XVVGEMMODLGULC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|