C23H20F3NS — CID 138486987
[4-[2-(2-cyclopropyl-3-fluoro-4-pentylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate (PubChem CID 138486987) has the molecular formula C23H20F3NS and a molecular weight of 399.48 g/mol. Its IUPAC name is [4-[2-(2-cyclopropyl-3-fluoro-4-pentylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate.
| Compound Name | [4-[2-(2-cyclopropyl-3-fluoro-4-pentylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 138486987 |
| Molecular Formula | C23H20F3NS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [4-[2-(2-cyclopropyl-3-fluoro-4-pentylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate |
| SMILES | CCCCCc1ccc(C#Cc2cc(F)c(SC#N)c(F)c2)c(C2CC2)c1F |
| InChI | InChI=1S/C23H20F3NS/c1-2-3-4-5-18-11-10-16(21(22(18)26)17-8-9-17)7-6-15-12-19(24)23(28-14-27)20(25)13-15/h10-13,17H,2-5,8-9H2,1H3 |
| InChIKey | JPYKQYFGTKSEQZ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|