C32H25F4NS — CID 174156983
[4-[2-[4-[2-(1,3-difluoro-6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate (PubChem CID 174156983) has the molecular formula C32H25F4NS and a molecular weight of 531.62 g/mol. Its IUPAC name is [4-[2-[4-[2-(1,3-difluoro-6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate.
| Compound Name | [4-[2-[4-[2-(1,3-difluoro-6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 174156983 |
| Molecular Formula | C32H25F4NS |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [4-[2-[4-[2-(1,3-difluoro-6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]phenyl]ethynyl]-2,6-difluorophenyl] thiocyanate |
| SMILES | CCCCCC1CCc2c(cc(F)c(C#Cc3ccc(C#Cc4cc(F)c(SC#N)c(F)c4)cc3)c2F)C1 |
| InChI | InChI=1S/C32H25F4NS/c1-2-3-4-5-23-13-14-26-25(16-23)19-28(33)27(31(26)36)15-12-22-8-6-21(7-9-22)10-11-24-17-29(34)32(38-20-37)30(35)18-24/h6-9,17-19,23H,2-5,13-14,16H2,1H3 |
| InChIKey | NGXSYQRUMHPXNV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|