C30H25F2NS — CID 169279831
5,7-difluoro-6-[2-[4-[(E)-2-(4-isothiocyanatophenyl)ethenyl]phenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279831) has the molecular formula C30H25F2NS and a molecular weight of 469.60 g/mol. Its IUPAC name is 5,7-difluoro-6-[2-[4-[(E)-2-(4-isothiocyanatophenyl)ethenyl]phenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7-difluoro-6-[2-[4-[(E)-2-(4-isothiocyanatophenyl)ethenyl]phenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279831 |
| Molecular Formula | C30H25F2NS |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 5,7-difluoro-6-[2-[4-[(E)-2-(4-isothiocyanatophenyl)ethenyl]phenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2c(cc(F)c(C#Cc3ccc(/C=C/c4ccc(N=C=S)cc4)cc3)c2F)C1 |
| InChI | InChI=1S/C30H25F2NS/c1-2-3-24-13-16-27-25(18-24)19-29(31)28(30(27)32)17-12-22-7-4-21(5-8-22)6-9-23-10-14-26(15-11-23)33-20-34/h4-11,14-15,19,24H,2-3,13,16,18H2,1H3/b9-6+ |
| InChIKey | ODYDMQAJTVYBNV-RMKNXTFCSA-N |
| XLogP | 8.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|