C32H33F2NS — CID 169279858
6-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]phenyl]-5,7-diethyl-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279858) has the molecular formula C32H33F2NS and a molecular weight of 501.69 g/mol. Its IUPAC name is 6-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]phenyl]-5,7-diethyl-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]phenyl]-5,7-diethyl-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279858 |
| Molecular Formula | C32H33F2NS |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 6-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]phenyl]-5,7-diethyl-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2c(cc(CC)c(-c3ccc(/C=C/c4cc(F)c(N=C=S)c(F)c4)cc3)c2CC)C1 |
| InChI | InChI=1S/C32H33F2NS/c1-4-7-22-12-15-28-26(16-22)19-24(5-2)31(27(28)6-3)25-13-10-21(11-14-25)8-9-23-17-29(33)32(35-20-36)30(34)18-23/h8-11,13-14,17-19,22H,4-7,12,15-16H2,1-3H3/b9-8+ |
| InChIKey | UPUUMVRQIZICNL-CMDGGOBGSA-N |
| XLogP | 9.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|