C30H21F6NS — CID 169279769
6-[2-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]-3,5-difluorophenyl]ethynyl]-5,7-difluoro-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279769) has the molecular formula C30H21F6NS and a molecular weight of 541.56 g/mol. Its IUPAC name is 6-[2-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]-3,5-difluorophenyl]ethynyl]-5,7-difluoro-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]-3,5-difluorophenyl]ethynyl]-5,7-difluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279769 |
| Molecular Formula | C30H21F6NS |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 6-[2-[4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]-3,5-difluorophenyl]ethynyl]-5,7-difluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2c(cc(F)c(C#Cc3cc(F)c(/C=C/c4cc(F)c(N=C=S)c(F)c4)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C30H21F6NS/c1-2-3-17-4-7-21-20(10-17)15-26(33)23(29(21)36)9-6-18-11-24(31)22(25(32)12-18)8-5-19-13-27(34)30(37-16-38)28(35)14-19/h5,8,11-15,17H,2-4,7,10H2,1H3/b8-5+ |
| InChIKey | RDNKWBSNSISZAY-VMPITWQZSA-N |
| XLogP | 8.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|