C23H21F5 — CID 58839594
5,7-difluoro-2-pentyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 58839594) has the molecular formula C23H21F5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 5,7-difluoro-2-pentyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7-difluoro-2-pentyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58839594 |
| Molecular Formula | C23H21F5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5,7-difluoro-2-pentyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC1CCc2c(cc(F)c(C#Cc3cc(F)c(F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C23H21F5/c1-2-3-4-5-14-6-8-17-16(10-14)13-19(24)18(22(17)27)9-7-15-11-20(25)23(28)21(26)12-15/h11-14H,2-6,8,10H2,1H3 |
| InChIKey | IPOYEAHNCDIHFE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|