C24H33F5O — CID 139848586
5,7-difluoro-2-[2-(4-pentylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139848586) has the molecular formula C24H33F5O and a molecular weight of 432.52 g/mol. Its IUPAC name is 5,7-difluoro-2-[2-(4-pentylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7-difluoro-2-[2-(4-pentylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139848586 |
| Molecular Formula | C24H33F5O |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5,7-difluoro-2-[2-(4-pentylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC1CCC(CCC2CCc3c(cc(F)c(OC(F)(F)F)c3F)C2)CC1 |
| InChI | InChI=1S/C24H33F5O/c1-2-3-4-5-16-6-8-17(9-7-16)10-11-18-12-13-20-19(14-18)15-21(25)23(22(20)26)30-24(27,28)29/h15-18H,2-14H2,1H3 |
| InChIKey | GZNPZGFMJSAHHF-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|