C22H23F5O — CID 139849085
5,7-difluoro-2-(4-pentylphenyl)-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139849085) has the molecular formula C22H23F5O and a molecular weight of 398.42 g/mol. Its IUPAC name is 5,7-difluoro-2-(4-pentylphenyl)-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7-difluoro-2-(4-pentylphenyl)-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139849085 |
| Molecular Formula | C22H23F5O |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 5,7-difluoro-2-(4-pentylphenyl)-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCc1ccc(C2CCc3c(cc(F)c(OC(F)(F)F)c3F)C2)cc1 |
| InChI | InChI=1S/C22H23F5O/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-11-18-17(12-16)13-19(23)21(20(18)24)28-22(25,26)27/h6-9,13,16H,2-5,10-12H2,1H3 |
| InChIKey | RPWWMKHBJVOIMU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|