C22H21F5O — CID 139952155
6,8-difluoro-3-(4-pentylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene (PubChem CID 139952155) has the molecular formula C22H21F5O and a molecular weight of 396.40 g/mol. Its IUPAC name is 6,8-difluoro-3-(4-pentylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene.
| Compound Name | 6,8-difluoro-3-(4-pentylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952155 |
| Molecular Formula | C22H21F5O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6,8-difluoro-3-(4-pentylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
| SMILES | CCCCCc1ccc(C2=Cc3cc(F)c(OC(F)(F)F)c(F)c3CC2)cc1 |
| InChI | InChI=1S/C22H21F5O/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-11-18-17(12-16)13-19(23)21(20(18)24)28-22(25,26)27/h6-9,12-13H,2-5,10-11H2,1H3 |
| InChIKey | JUYSHBKTPNNUQO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|