C20H20F2 — CID 139961229
3-(4-butylphenyl)-6,7-difluoro-1,2-dihydronaphthalene (PubChem CID 139961229) has the molecular formula C20H20F2 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-(4-butylphenyl)-6,7-difluoro-1,2-dihydronaphthalene.
| Compound Name | 3-(4-butylphenyl)-6,7-difluoro-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961229 |
| Molecular Formula | C20H20F2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-(4-butylphenyl)-6,7-difluoro-1,2-dihydronaphthalene |
| SMILES | CCCCc1ccc(C2=Cc3cc(F)c(F)cc3CC2)cc1 |
| InChI | InChI=1S/C20H20F2/c1-2-3-4-14-5-7-15(8-6-14)16-9-10-17-12-19(21)20(22)13-18(17)11-16/h5-8,11-13H,2-4,9-10H2,1H3 |
| InChIKey | WTCPDTFPOFLQSK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|