C20H18F4 — CID 139961103
3-(4-butyl-2,6-difluorophenyl)-6,7-difluoro-1,2-dihydronaphthalene (PubChem CID 139961103) has the molecular formula C20H18F4 and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-(4-butyl-2,6-difluorophenyl)-6,7-difluoro-1,2-dihydronaphthalene.
| Compound Name | 3-(4-butyl-2,6-difluorophenyl)-6,7-difluoro-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961103 |
| Molecular Formula | C20H18F4 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-(4-butyl-2,6-difluorophenyl)-6,7-difluoro-1,2-dihydronaphthalene |
| SMILES | CCCCc1cc(F)c(C2=Cc3cc(F)c(F)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C20H18F4/c1-2-3-4-12-7-18(23)20(19(24)8-12)14-6-5-13-10-16(21)17(22)11-15(13)9-14/h7-11H,2-6H2,1H3 |
| InChIKey | HNKJNFGAJAMAHV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|