C20H17F5O — CID 139961115
6-fluoro-3-(2-fluoro-4-propylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene (PubChem CID 139961115) has the molecular formula C20H17F5O and a molecular weight of 368.35 g/mol. Its IUPAC name is 6-fluoro-3-(2-fluoro-4-propylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene.
| Compound Name | 6-fluoro-3-(2-fluoro-4-propylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961115 |
| Molecular Formula | C20H17F5O |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 6-fluoro-3-(2-fluoro-4-propylphenyl)-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
| SMILES | CCCc1ccc(C2=Cc3cc(F)c(OC(F)(F)F)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C20H17F5O/c1-2-3-12-4-7-16(17(21)8-12)14-6-5-13-11-19(26-20(23,24)25)18(22)10-15(13)9-14/h4,7-11H,2-3,5-6H2,1H3 |
| InChIKey | XPONBJNYOHXULZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|