C18H16F2 — CID 139952241
3-(4-ethyl-2-fluorophenyl)-7-fluoro-1,2-dihydronaphthalene (PubChem CID 139952241) has the molecular formula C18H16F2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-(4-ethyl-2-fluorophenyl)-7-fluoro-1,2-dihydronaphthalene.
| Compound Name | 3-(4-ethyl-2-fluorophenyl)-7-fluoro-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952241 |
| Molecular Formula | C18H16F2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-(4-ethyl-2-fluorophenyl)-7-fluoro-1,2-dihydronaphthalene |
| SMILES | CCc1ccc(C2=Cc3ccc(F)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C18H16F2/c1-2-12-3-8-17(18(20)9-12)15-5-4-14-11-16(19)7-6-13(14)10-15/h3,6-11H,2,4-5H2,1H3 |
| InChIKey | KSQUQEWQBPOREF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|