C21H22F2O — CID 139961426
3-(4-butyl-2-fluorophenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene (PubChem CID 139961426) has the molecular formula C21H22F2O and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-(4-butyl-2-fluorophenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene.
| Compound Name | 3-(4-butyl-2-fluorophenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961426 |
| Molecular Formula | C21H22F2O |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-(4-butyl-2-fluorophenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene |
| SMILES | CCCCc1ccc(C2=Cc3cc(F)c(OC)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C21H22F2O/c1-3-4-5-14-6-9-18(19(22)10-14)16-8-7-15-13-21(24-2)20(23)12-17(15)11-16/h6,9-13H,3-5,7-8H2,1-2H3 |
| InChIKey | GSRRVWYOBVEOJI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|