C22H24F2O — CID 139961212
6-fluoro-3-(2-fluoro-4-pentylphenyl)-7-methoxy-1,2-dihydronaphthalene (PubChem CID 139961212) has the molecular formula C22H24F2O and a molecular weight of 342.43 g/mol. Its IUPAC name is 6-fluoro-3-(2-fluoro-4-pentylphenyl)-7-methoxy-1,2-dihydronaphthalene.
| Compound Name | 6-fluoro-3-(2-fluoro-4-pentylphenyl)-7-methoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961212 |
| Molecular Formula | C22H24F2O |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 6-fluoro-3-(2-fluoro-4-pentylphenyl)-7-methoxy-1,2-dihydronaphthalene |
| SMILES | CCCCCc1ccc(C2=Cc3cc(F)c(OC)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C22H24F2O/c1-3-4-5-6-15-7-10-19(20(23)11-15)17-9-8-16-14-22(25-2)21(24)13-18(16)12-17/h7,10-14H,3-6,8-9H2,1-2H3 |
| InChIKey | CHRKAEMECMWGKT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|