C19H15F5O — CID 139961089
3-(4-ethyl-2-fluorophenyl)-6-fluoro-7-(trifluoromethoxy)-1,2-dihydronaphthalene (PubChem CID 139961089) has the molecular formula C19H15F5O and a molecular weight of 354.32 g/mol. Its IUPAC name is 3-(4-ethyl-2-fluorophenyl)-6-fluoro-7-(trifluoromethoxy)-1,2-dihydronaphthalene.
| Compound Name | 3-(4-ethyl-2-fluorophenyl)-6-fluoro-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961089 |
| Molecular Formula | C19H15F5O |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-(4-ethyl-2-fluorophenyl)-6-fluoro-7-(trifluoromethoxy)-1,2-dihydronaphthalene |
| SMILES | CCc1ccc(C2=Cc3cc(F)c(OC(F)(F)F)cc3CC2)c(F)c1 |
| InChI | InChI=1S/C19H15F5O/c1-2-11-3-6-15(16(20)7-11)13-5-4-12-10-18(25-19(22,23)24)17(21)9-14(12)8-13/h3,6-10H,2,4-5H2,1H3 |
| InChIKey | CCUSGRNYRIUTJH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|