C20H19F3O — CID 139961178
3-(2,3-difluoro-4-propylphenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene (PubChem CID 139961178) has the molecular formula C20H19F3O and a molecular weight of 332.37 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-propylphenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene.
| Compound Name | 3-(2,3-difluoro-4-propylphenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961178 |
| Molecular Formula | C20H19F3O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-(2,3-difluoro-4-propylphenyl)-6-fluoro-7-methoxy-1,2-dihydronaphthalene |
| SMILES | CCCc1ccc(C2=Cc3cc(F)c(OC)cc3CC2)c(F)c1F |
| InChI | InChI=1S/C20H19F3O/c1-3-4-12-7-8-16(20(23)19(12)22)14-6-5-13-11-18(24-2)17(21)10-15(13)9-14/h7-11H,3-6H2,1-2H3 |
| InChIKey | XLLHMWRNNDPCLS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|