C27H23F5O — CID 139961395
3-(4-butyl-2,3-difluorophenyl)-7-(2,3-difluoro-4-methoxyphenyl)-6-fluoro-1,2-dihydronaphthalene (PubChem CID 139961395) has the molecular formula C27H23F5O and a molecular weight of 458.47 g/mol. Its IUPAC name is 3-(4-butyl-2,3-difluorophenyl)-7-(2,3-difluoro-4-methoxyphenyl)-6-fluoro-1,2-dihydronaphthalene.
| Compound Name | 3-(4-butyl-2,3-difluorophenyl)-7-(2,3-difluoro-4-methoxyphenyl)-6-fluoro-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961395 |
| Molecular Formula | C27H23F5O |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-(4-butyl-2,3-difluorophenyl)-7-(2,3-difluoro-4-methoxyphenyl)-6-fluoro-1,2-dihydronaphthalene |
| SMILES | CCCCc1ccc(C2=Cc3cc(F)c(-c4ccc(OC)c(F)c4F)cc3CC2)c(F)c1F |
| InChI | InChI=1S/C27H23F5O/c1-3-4-5-15-8-9-19(25(30)24(15)29)17-7-6-16-13-21(22(28)14-18(16)12-17)20-10-11-23(33-2)27(32)26(20)31/h8-14H,3-7H2,1-2H3 |
| InChIKey | NZGXKWCZRFWNDQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|