C27H24F4 — CID 139960643
7-(4-ethyl-2,3-difluorophenyl)-8-fluoro-3-(2-fluoro-4-propylphenyl)-1,2-dihydronaphthalene (PubChem CID 139960643) has the molecular formula C27H24F4 and a molecular weight of 424.48 g/mol. Its IUPAC name is 7-(4-ethyl-2,3-difluorophenyl)-8-fluoro-3-(2-fluoro-4-propylphenyl)-1,2-dihydronaphthalene.
| Compound Name | 7-(4-ethyl-2,3-difluorophenyl)-8-fluoro-3-(2-fluoro-4-propylphenyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139960643 |
| Molecular Formula | C27H24F4 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 7-(4-ethyl-2,3-difluorophenyl)-8-fluoro-3-(2-fluoro-4-propylphenyl)-1,2-dihydronaphthalene |
| SMILES | CCCc1ccc(C2=Cc3ccc(-c4ccc(CC)c(F)c4F)c(F)c3CC2)c(F)c1 |
| InChI | InChI=1S/C27H24F4/c1-3-5-16-6-10-20(24(28)14-16)18-8-11-21-19(15-18)9-13-22(26(21)30)23-12-7-17(4-2)25(29)27(23)31/h6-7,9-10,12-15H,3-5,8,11H2,1-2H3 |
| InChIKey | FJLIFQLABPUNTP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|