C26H20F6O — CID 139960351
3-(2,6-difluoro-4-propylphenyl)-8-fluoro-7-[4-(trifluoromethoxy)phenyl]-1,2-dihydronaphthalene (PubChem CID 139960351) has the molecular formula C26H20F6O and a molecular weight of 462.43 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-propylphenyl)-8-fluoro-7-[4-(trifluoromethoxy)phenyl]-1,2-dihydronaphthalene.
| Compound Name | 3-(2,6-difluoro-4-propylphenyl)-8-fluoro-7-[4-(trifluoromethoxy)phenyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139960351 |
| Molecular Formula | C26H20F6O |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-(2,6-difluoro-4-propylphenyl)-8-fluoro-7-[4-(trifluoromethoxy)phenyl]-1,2-dihydronaphthalene |
| SMILES | CCCc1cc(F)c(C2=Cc3ccc(-c4ccc(OC(F)(F)F)cc4)c(F)c3CC2)c(F)c1 |
| InChI | InChI=1S/C26H20F6O/c1-2-3-15-12-22(27)24(23(28)13-15)18-7-11-21-17(14-18)6-10-20(25(21)29)16-4-8-19(9-5-16)33-26(30,31)32/h4-6,8-10,12-14H,2-3,7,11H2,1H3 |
| InChIKey | QBPQDFGKZSOCSL-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|