C23H18F4O — CID 22045360
1-fluoro-7-propyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene (PubChem CID 22045360) has the molecular formula C23H18F4O and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-fluoro-7-propyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene.
| Compound Name | 1-fluoro-7-propyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
|---|---|
| PubChem CID | 22045360 |
| Molecular Formula | C23H18F4O |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-fluoro-7-propyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
| SMILES | CCCc1ccc2c(c1)Cc1c-2ccc(-c2ccc(OC(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C23H18F4O/c1-2-3-14-4-9-18-16(12-14)13-21-20(18)11-10-19(22(21)24)15-5-7-17(8-6-15)28-23(25,26)27/h4-12H,2-3,13H2,1H3 |
| InChIKey | GUEGGUJCAFTBHR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |