C25H19F7O — CID 139883527
2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,3-difluoro-7-pentyl-9H-fluorene (PubChem CID 139883527) has the molecular formula C25H19F7O and a molecular weight of 468.41 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,3-difluoro-7-pentyl-9H-fluorene.
| Compound Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,3-difluoro-7-pentyl-9H-fluorene |
|---|---|
| PubChem CID | 139883527 |
| Molecular Formula | C25H19F7O |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,3-difluoro-7-pentyl-9H-fluorene |
| SMILES | CCCCCc1ccc2c(c1)Cc1c-2cc(F)c(-c2cc(F)c(OC(F)(F)F)c(F)c2)c1F |
| InChI | InChI=1S/C25H19F7O/c1-2-3-4-5-13-6-7-16-14(8-13)9-18-17(16)12-19(26)22(23(18)29)15-10-20(27)24(21(28)11-15)33-25(30,31)32/h6-8,10-12H,2-5,9H2,1H3 |
| InChIKey | XBWVFUUSLIKRTO-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|