C28H23F7O — CID 139949001
5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene (PubChem CID 139949001) has the molecular formula C28H23F7O and a molecular weight of 508.48 g/mol. Its IUPAC name is 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene.
| Compound Name | 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139949001 |
| Molecular Formula | C28H23F7O |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene |
| SMILES | CCCCCc1ccc(C2=CCc3c(cc(F)c(-c4ccc(OC(F)(F)F)c(F)c4)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C28H23F7O/c1-2-3-4-5-16-6-9-20(22(29)12-16)17-7-10-21-19(13-17)15-24(31)26(27(21)32)18-8-11-25(23(30)14-18)36-28(33,34)35/h6-9,11-12,14-15H,2-5,10,13H2,1H3 |
| InChIKey | NQKZRSAMYSSMRZ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|