C23H21F7O — CID 139949009
6-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-5,7-difluoro-2-hexyl-1,4-dihydronaphthalene (PubChem CID 139949009) has the molecular formula C23H21F7O and a molecular weight of 446.41 g/mol. Its IUPAC name is 6-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-5,7-difluoro-2-hexyl-1,4-dihydronaphthalene.
| Compound Name | 6-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-5,7-difluoro-2-hexyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139949009 |
| Molecular Formula | C23H21F7O |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 6-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-5,7-difluoro-2-hexyl-1,4-dihydronaphthalene |
| SMILES | CCCCCCC1=CCc2c(cc(F)c(-c3cc(F)c(OC(F)(F)F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C23H21F7O/c1-2-3-4-5-6-13-7-8-16-14(9-13)10-17(24)20(21(16)27)15-11-18(25)22(19(26)12-15)31-23(28,29)30/h7,10-12H,2-6,8-9H2,1H3 |
| InChIKey | GQCVIYJOFSAUES-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|