C30H35F5 — CID 139948696
5,7-difluoro-2-[2-(4-hexylcyclohexyl)ethyl]-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139948696) has the molecular formula C30H35F5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 5,7-difluoro-2-[2-(4-hexylcyclohexyl)ethyl]-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene.
| Compound Name | 5,7-difluoro-2-[2-(4-hexylcyclohexyl)ethyl]-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948696 |
| Molecular Formula | C30H35F5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 5,7-difluoro-2-[2-(4-hexylcyclohexyl)ethyl]-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCCCC1CCC(CCC2=CCc3c(cc(F)c(-c4cc(F)c(F)c(F)c4)c3F)C2)CC1 |
| InChI | InChI=1S/C30H35F5/c1-2-3-4-5-6-19-7-9-20(10-8-19)11-12-21-13-14-24-22(15-21)16-25(31)28(29(24)34)23-17-26(32)30(35)27(33)18-23/h13,16-20H,2-12,14-15H2,1H3 |
| InChIKey | UOCMOGJBGKQRFM-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|