C23H29F5O — CID 139948948
2-[2-(4-butylcyclohexyl)ethyl]-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene (PubChem CID 139948948) has the molecular formula C23H29F5O and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[2-(4-butylcyclohexyl)ethyl]-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene.
| Compound Name | 2-[2-(4-butylcyclohexyl)ethyl]-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948948 |
| Molecular Formula | C23H29F5O |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[2-(4-butylcyclohexyl)ethyl]-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
| SMILES | CCCCC1CCC(CCC2=CCc3c(cc(F)c(OC(F)(F)F)c3F)C2)CC1 |
| InChI | InChI=1S/C23H29F5O/c1-2-3-4-15-5-7-16(8-6-15)9-10-17-11-12-19-18(13-17)14-20(24)22(21(19)25)29-23(26,27)28/h11,14-16H,2-10,12-13H2,1H3 |
| InChIKey | ASJDKTUTKQLNJX-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|