C19H21F5O — CID 139948906
2-(4-ethylcyclohexyl)-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene (PubChem CID 139948906) has the molecular formula C19H21F5O and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene.
| Compound Name | 2-(4-ethylcyclohexyl)-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948906 |
| Molecular Formula | C19H21F5O |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(4-ethylcyclohexyl)-5,7-difluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
| SMILES | CCC1CCC(C2=CCc3c(cc(F)c(OC(F)(F)F)c3F)C2)CC1 |
| InChI | InChI=1S/C19H21F5O/c1-2-11-3-5-12(6-4-11)13-7-8-15-14(9-13)10-16(20)18(17(15)21)25-19(22,23)24/h7,10-12H,2-6,8-9H2,1H3 |
| InChIKey | CXKBSOQAJNONEI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|