C27H29F5O — CID 139960803
2-[2-(4-ethylcyclohexyl)ethyl]-5-fluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene (PubChem CID 139960803) has the molecular formula C27H29F5O and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[2-(4-ethylcyclohexyl)ethyl]-5-fluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene.
| Compound Name | 2-[2-(4-ethylcyclohexyl)ethyl]-5-fluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139960803 |
| Molecular Formula | C27H29F5O |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[2-(4-ethylcyclohexyl)ethyl]-5-fluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,4-dihydronaphthalene |
| SMILES | CCC1CCC(CCC2=CCc3c(ccc(-c4ccc(OC(F)(F)F)c(F)c4)c3F)C2)CC1 |
| InChI | InChI=1S/C27H29F5O/c1-2-17-3-5-18(6-4-17)7-8-19-9-12-22-20(15-19)10-13-23(26(22)29)21-11-14-25(24(28)16-21)33-27(30,31)32/h9-11,13-14,16-18H,2-8,12,15H2,1H3 |
| InChIKey | KZAVJRJMLHYLSF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|