C22H22F4 — CID 139960719
5-fluoro-2-hexyl-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139960719) has the molecular formula C22H22F4 and a molecular weight of 362.41 g/mol. Its IUPAC name is 5-fluoro-2-hexyl-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene.
| Compound Name | 5-fluoro-2-hexyl-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139960719 |
| Molecular Formula | C22H22F4 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 5-fluoro-2-hexyl-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCCCC1=CCc2c(ccc(-c3cc(F)c(F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C22H22F4/c1-2-3-4-5-6-14-7-9-17-15(11-14)8-10-18(21(17)25)16-12-19(23)22(26)20(24)13-16/h7-8,10,12-13H,2-6,9,11H2,1H3 |
| InChIKey | YSYGGNMRQMPZTM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|