C27H22F6 — CID 139960805
2-(2,6-difluoro-4-pentylphenyl)-5-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139960805) has the molecular formula C27H22F6 and a molecular weight of 460.46 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-pentylphenyl)-5-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene.
| Compound Name | 2-(2,6-difluoro-4-pentylphenyl)-5-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139960805 |
| Molecular Formula | C27H22F6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-(2,6-difluoro-4-pentylphenyl)-5-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCCc1cc(F)c(C2=CCc3c(ccc(-c4cc(F)c(F)c(F)c4)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C27H22F6/c1-2-3-4-5-15-10-21(28)25(22(29)11-15)17-7-9-19-16(12-17)6-8-20(26(19)32)18-13-23(30)27(33)24(31)14-18/h6-8,10-11,13-14H,2-5,9,12H2,1H3 |
| InChIKey | BRNQOIDALNQFRU-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|