C26H22F4 — CID 139961496
2-(4-butylphenyl)-7-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139961496) has the molecular formula C26H22F4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-(4-butylphenyl)-7-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene.
| Compound Name | 2-(4-butylphenyl)-7-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961496 |
| Molecular Formula | C26H22F4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-(4-butylphenyl)-7-fluoro-6-(3,4,5-trifluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCc1ccc(C2=CCc3cc(-c4cc(F)c(F)c(F)c4)c(F)cc3C2)cc1 |
| InChI | InChI=1S/C26H22F4/c1-2-3-4-16-5-7-17(8-6-16)18-9-10-19-12-22(23(27)13-20(19)11-18)21-14-24(28)26(30)25(29)15-21/h5-9,12-15H,2-4,10-11H2,1H3 |
| InChIKey | FOGAIBBNTSYKIH-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|