C22H19F4N — CID 139948656
6-(2,6-difluoro-4-pentylphenyl)-1,3-difluoro-5,8-dihydronaphthalene-2-carbonitrile (PubChem CID 139948656) has the molecular formula C22H19F4N and a molecular weight of 373.39 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-pentylphenyl)-1,3-difluoro-5,8-dihydronaphthalene-2-carbonitrile.
| Compound Name | 6-(2,6-difluoro-4-pentylphenyl)-1,3-difluoro-5,8-dihydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139948656 |
| Molecular Formula | C22H19F4N |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 6-(2,6-difluoro-4-pentylphenyl)-1,3-difluoro-5,8-dihydronaphthalene-2-carbonitrile |
| SMILES | CCCCCc1cc(F)c(C2=CCc3c(cc(F)c(C#N)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C22H19F4N/c1-2-3-4-5-13-8-19(24)21(20(25)9-13)14-6-7-16-15(10-14)11-18(23)17(12-27)22(16)26/h6,8-9,11H,2-5,7,10H2,1H3 |
| InChIKey | BEQKPRGXSAPNLV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|