About 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene
2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139948913) has the molecular formula C20H19F3
and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene |
| PubChem CID | 139948913 |
| Molecular Formula | C20H19F3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCC1=CCc2c(cc(F)c(-c3ccc(F)cc3)c2F)C1 |
| InChI | InChI=1S/C20H19F3/c1-2-3-4-13-5-10-17-15(11-13)12-18(22)19(20(17)23)14-6-8-16(21)9-7-14/h5-9,12H,2-4,10-11H2,1H3 |
| InChIKey | BIRSPTCCBBMFEI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene?
The IUPAC name of 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene (CID 139948913) is 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene.
What is the SMILES notation for 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene?
The canonical SMILES for 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene is CCCCC1=CCc2c(cc(F)c(-c3ccc(F)cc3)c2F)C1.
What is the InChIKey of 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene?
The InChIKey is BIRSPTCCBBMFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3/c1-2-3-4-13-5-10-17-15(11-13)12-18(22)19(20(17)23)14-6-8-16(21)9-7-14/h5-9,12H,2-4,10-11H2,1H3.
What are the key properties of 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene?
2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene has a molecular weight of 316.37 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene is sourced from PubChem (CID 139948913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).