C20H19F3 — CID 139948913
2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene (PubChem CID 139948913) has the molecular formula C20H19F3 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene.
| Compound Name | 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948913 |
| Molecular Formula | C20H19F3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-butyl-5,7-difluoro-6-(4-fluorophenyl)-1,4-dihydronaphthalene |
| SMILES | CCCCC1=CCc2c(cc(F)c(-c3ccc(F)cc3)c2F)C1 |
| InChI | InChI=1S/C20H19F3/c1-2-3-4-13-5-10-17-15(11-13)12-18(22)19(20(17)23)14-6-8-16(21)9-7-14/h5-9,12H,2-4,10-11H2,1H3 |
| InChIKey | BIRSPTCCBBMFEI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|