C15H18Cl2 — CID 139948672
5,7-dichloro-2-pentyl-1,4-dihydronaphthalene (PubChem CID 139948672) has the molecular formula C15H18Cl2 and a molecular weight of 269.21 g/mol. Its IUPAC name is 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene.
| Compound Name | 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948672 |
| Molecular Formula | C15H18Cl2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene |
| SMILES | CCCCCC1=CCc2c(Cl)cc(Cl)cc2C1 |
| InChI | InChI=1S/C15H18Cl2/c1-2-3-4-5-11-6-7-14-12(8-11)9-13(16)10-15(14)17/h6,9-10H,2-5,7-8H2,1H3 |
| InChIKey | YUQVVWWYGVJIQS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|