About 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene
5,7-dichloro-2-pentyl-1,4-dihydronaphthalene (PubChem CID 139948672) has the molecular formula C15H18Cl2
and a molecular weight of 269.21 g/mol. Its IUPAC name is 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene |
| PubChem CID | 139948672 |
| Molecular Formula | C15H18Cl2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene |
| SMILES | CCCCCC1=CCc2c(Cl)cc(Cl)cc2C1 |
| InChI | InChI=1S/C15H18Cl2/c1-2-3-4-5-11-6-7-14-12(8-11)9-13(16)10-15(14)17/h6,9-10H,2-5,7-8H2,1H3 |
| InChIKey | YUQVVWWYGVJIQS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene?
The IUPAC name of 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene (CID 139948672) is 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene.
What is the SMILES notation for 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene?
The canonical SMILES for 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene is CCCCCC1=CCc2c(Cl)cc(Cl)cc2C1.
What is the InChIKey of 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene?
The InChIKey is YUQVVWWYGVJIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Cl2/c1-2-3-4-5-11-6-7-14-12(8-11)9-13(16)10-15(14)17/h6,9-10H,2-5,7-8H2,1H3.
What are the key properties of 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene?
5,7-dichloro-2-pentyl-1,4-dihydronaphthalene has a molecular weight of 269.21 g/mol, XLogP of 5.60, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-pentyl-1,4-dihydronaphthalene is sourced from PubChem (CID 139948672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).