C14H17F — CID 139961729
2-butyl-7-fluoro-1,4-dihydronaphthalene (PubChem CID 139961729) has the molecular formula C14H17F and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-butyl-7-fluoro-1,4-dihydronaphthalene.
| Compound Name | 2-butyl-7-fluoro-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961729 |
| Molecular Formula | C14H17F |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-butyl-7-fluoro-1,4-dihydronaphthalene |
| SMILES | CCCCC1=CCc2ccc(F)cc2C1 |
| InChI | InChI=1S/C14H17F/c1-2-3-4-11-5-6-12-7-8-14(15)10-13(12)9-11/h5,7-8,10H,2-4,6,9H2,1H3 |
| InChIKey | SLVFHBMVFNGWEG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|