C20H18F2O2 — CID 139961721
(4-fluorophenyl) 3-fluoro-6-propyl-5,8-dihydronaphthalene-2-carboxylate (PubChem CID 139961721) has the molecular formula C20H18F2O2 and a molecular weight of 328.36 g/mol. Its IUPAC name is (4-fluorophenyl) 3-fluoro-6-propyl-5,8-dihydronaphthalene-2-carboxylate.
| Compound Name | (4-fluorophenyl) 3-fluoro-6-propyl-5,8-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139961721 |
| Molecular Formula | C20H18F2O2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (4-fluorophenyl) 3-fluoro-6-propyl-5,8-dihydronaphthalene-2-carboxylate |
| SMILES | CCCC1=CCc2cc(C(=O)Oc3ccc(F)cc3)c(F)cc2C1 |
| InChI | InChI=1S/C20H18F2O2/c1-2-3-13-4-5-14-11-18(19(22)12-15(14)10-13)20(23)24-17-8-6-16(21)7-9-17/h4,6-9,11-12H,2-3,5,10H2,1H3 |
| InChIKey | YIFUFTFYFNOKKN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|