C21H22F4O3 — CID 161307729
(4-fluorophenyl) 2,4-difluorobenzoate;4-methylcyclohexane-1-carbonyl fluoride;molecular hydrogen (PubChem CID 161307729) has the molecular formula C21H22F4O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is (4-fluorophenyl) 2,4-difluorobenzoate;4-methylcyclohexane-1-carbonyl fluoride;molecular hydrogen.
| Compound Name | (4-fluorophenyl) 2,4-difluorobenzoate;4-methylcyclohexane-1-carbonyl fluoride;molecular hydrogen |
|---|---|
| PubChem CID | 161307729 |
| Molecular Formula | C21H22F4O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (4-fluorophenyl) 2,4-difluorobenzoate;4-methylcyclohexane-1-carbonyl fluoride;molecular hydrogen |
| SMILES | CC1CCC(C(=O)F)CC1.O=C(Oc1ccc(F)cc1)c1ccc(F)cc1F.[H][H] |
| InChI | InChI=1S/C13H7F3O2.C8H13FO.H2/c14-8-1-4-10(5-2-8)18-13(17)11-6-3-9(15)7-12(11)16;1-6-2-4-7(5-3-6)8(9)10;/h1-7H;6-7H,2-5H2,1H3;1H |
| InChIKey | VIMBGTSQZJEHBV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|