C15H18F2O — CID 64728885
(2,4-difluorophenyl)-(3,5-dimethylcyclohexyl)methanone (PubChem CID 64728885) has the molecular formula C15H18F2O and a molecular weight of 252.30 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(3,5-dimethylcyclohexyl)methanone.
| Compound Name | (2,4-difluorophenyl)-(3,5-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 64728885 |
| Molecular Formula | C15H18F2O |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2,4-difluorophenyl)-(3,5-dimethylcyclohexyl)methanone |
| SMILES | CC1CC(C)CC(C(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H18F2O/c1-9-5-10(2)7-11(6-9)15(18)13-4-3-12(16)8-14(13)17/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | YKONHQZFOPNRBN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |