C10H8F2OS — CID 164657486
(2,4-difluorophenyl)-(thietan-3-yl)methanone (PubChem CID 164657486) has the molecular formula C10H8F2OS and a molecular weight of 214.24 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(thietan-3-yl)methanone.
| Compound Name | (2,4-difluorophenyl)-(thietan-3-yl)methanone |
|---|---|
| PubChem CID | 164657486 |
| Molecular Formula | C10H8F2OS |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (2,4-difluorophenyl)-(thietan-3-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1F)C1CSC1 |
| InChI | InChI=1S/C10H8F2OS/c11-7-1-2-8(9(12)3-7)10(13)6-4-14-5-6/h1-3,6H,4-5H2 |
| InChIKey | VKLVHXLNNOWSQE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |