C12H11F2NO2 — CID 151260037
1-[3-(2,4-difluorobenzoyl)azetidin-1-yl]ethanone (PubChem CID 151260037) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 1-[3-(2,4-difluorobenzoyl)azetidin-1-yl]ethanone.
| Compound Name | 1-[3-(2,4-difluorobenzoyl)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 151260037 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-[3-(2,4-difluorobenzoyl)azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C12H11F2NO2/c1-7(16)15-5-8(6-15)12(17)10-3-2-9(13)4-11(10)14/h2-4,8H,5-6H2,1H3 |
| InChIKey | NUDVWIWWFTYDIG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |