C14H15ClFNO2 — CID 23048180
1-[4-(4-chloro-2-fluorobenzoyl)piperidin-1-yl]ethanone (PubChem CID 23048180) has the molecular formula C14H15ClFNO2 and a molecular weight of 283.73 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-fluorobenzoyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(4-chloro-2-fluorobenzoyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 23048180 |
| Molecular Formula | C14H15ClFNO2 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[4-(4-chloro-2-fluorobenzoyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)c2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C14H15ClFNO2/c1-9(18)17-6-4-10(5-7-17)14(19)12-3-2-11(15)8-13(12)16/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | LPGXXILLGWQVLI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |