C15H18ClFO — CID 64739429
(4-chloro-2-fluorophenyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 64739429) has the molecular formula C15H18ClFO and a molecular weight of 268.76 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (4-chloro-2-fluorophenyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 64739429 |
| Molecular Formula | C15H18ClFO |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2ccc(Cl)cc2F)CC1C |
| InChI | InChI=1S/C15H18ClFO/c1-9-3-4-11(7-10(9)2)15(18)13-6-5-12(16)8-14(13)17/h5-6,8-11H,3-4,7H2,1-2H3 |
| InChIKey | RHZLKJLSHZVDHB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |