C15H18BrClO — CID 114975403
(5-bromo-2-chlorophenyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 114975403) has the molecular formula C15H18BrClO and a molecular weight of 329.67 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (5-bromo-2-chlorophenyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975403 |
| Molecular Formula | C15H18BrClO |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2cc(Br)ccc2Cl)CC1C |
| InChI | InChI=1S/C15H18BrClO/c1-9-3-4-11(7-10(9)2)15(18)13-8-12(16)5-6-14(13)17/h5-6,8-11H,3-4,7H2,1-2H3 |
| InChIKey | OMCFQJFRYOEKOF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |