C19H28O — CID 114975502
(2-tert-butylphenyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 114975502) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (2-tert-butylphenyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (2-tert-butylphenyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975502 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (2-tert-butylphenyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2ccccc2C(C)(C)C)CC1C |
| InChI | InChI=1S/C19H28O/c1-13-10-11-15(12-14(13)2)18(20)16-8-6-7-9-17(16)19(3,4)5/h6-9,13-15H,10-12H2,1-5H3 |
| InChIKey | IHOADAHNYRSVHX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |