C13H18OS — CID 64740221
(3,4-dimethylcyclohexyl)-thiophen-2-ylmethanone (PubChem CID 64740221) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-thiophen-2-ylmethanone.
| Compound Name | (3,4-dimethylcyclohexyl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 64740221 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-thiophen-2-ylmethanone |
| SMILES | CC1CCC(C(=O)c2cccs2)CC1C |
| InChI | InChI=1S/C13H18OS/c1-9-5-6-11(8-10(9)2)13(14)12-4-3-7-15-12/h3-4,7,9-11H,5-6,8H2,1-2H3 |
| InChIKey | BCKJWXHXUMIFSB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |