C15H17BrF2O — CID 107538024
(2-bromo-3,4-difluorophenyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 107538024) has the molecular formula C15H17BrF2O and a molecular weight of 331.20 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 107538024 |
| Molecular Formula | C15H17BrF2O |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2ccc(F)c(F)c2Br)CC1C |
| InChI | InChI=1S/C15H17BrF2O/c1-8-3-4-10(7-9(8)2)15(19)11-5-6-12(17)14(18)13(11)16/h5-6,8-10H,3-4,7H2,1-2H3 |
| InChIKey | HHRQUGJORUVIOF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|