C14H13BrF2O — CID 114245834
2-bicyclo[2.2.1]heptanyl-(2-bromo-3,4-difluorophenyl)methanone (PubChem CID 114245834) has the molecular formula C14H13BrF2O and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-(2-bromo-3,4-difluorophenyl)methanone.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-(2-bromo-3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 114245834 |
| Molecular Formula | C14H13BrF2O |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-(2-bromo-3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Br)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H13BrF2O/c15-12-9(3-4-11(16)13(12)17)14(18)10-6-7-1-2-8(10)5-7/h3-4,7-8,10H,1-2,5-6H2 |
| InChIKey | XJIOBXCMYZKOIS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|